CAS 1613467-47-2 is the registry number for Tyrosinase-IN-35. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(Z)-[3-(4-hydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea (CAS 1613467-47-2) is a chemical compound with the molecular formula C17H15N5OS and a molecular weight of 337.4 g/mol. IUPAC name: [(Z)-[3-(4-hydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea. InChIKey: KMXDZUKSJXNJOH-GRSHGNNSSA-N.
| Molecular formula | C17H15N5OS |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | [(Z)-[3-(4-hydroxyphenyl)-1-phenylpyrazol-4-yl]methylideneamino]thiourea |
| InChIKey | KMXDZUKSJXNJOH-GRSHGNNSSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)O)/C=N\NC(=S)N |
Computed by PubChem (NCBI)