Products 1613629-95-0
CAS 1613629-95-0 is the registry number for (8R,9aS)-8-hydroxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
(8R,9aS)-8-hydroxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one (CAS 1613629-95-0) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. IUPAC name: (8R,9aS)-8-hydroxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one. InChIKey: AYWUGJFKBSWUCK-RQJHMYQMSA-N.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | (8R,9aS)-8-hydroxy-2,3,4,5,7,8,9,9a-octahydropyrrolo[1,2-a][1,4]diazepin-1-one |
| InChIKey | AYWUGJFKBSWUCK-RQJHMYQMSA-N |
| SMILES | C1CNC(=O)[C@@H]2C[C@H](CN2C1)O |
Computed by PubChem (NCBI)