CAS 1613714-31-0 appears in our catalog under these names: Potassium ((4-bromophenyl)methyl)trifluoroboranuide, 98%, Potassium ((4-bromophenyl)methyl)trifluoroboranuide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
Potassium (4-bromophenyl)methyl-trifluoroboranuide (CAS 1613714-31-0) is a chemical compound with the molecular formula C7H6BBrF3K and a molecular weight of 276.93 g/mol. IUPAC name: potassium (4-bromophenyl)methyl-trifluoroboranuide. InChIKey: PZYWQZDIOYGXSR-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrF3K |
|---|---|
| Molecular weight | 276.93 g/mol |
| IUPAC name | potassium (4-bromophenyl)methyl-trifluoroboranuide |
| InChIKey | PZYWQZDIOYGXSR-UHFFFAOYSA-N |
| SMILES | [B-](CC1=CC=C(C=C1)Br)(F)(F)F.[K+] |
Computed by PubChem (NCBI)