CAS 1613751-69-1 appears in our catalog under these names: 2-Chloro-1h,4h-pyrrolo[2,1-f][1,2,4]triazin-4-one, 95%, 2-Chloropyrrolo(2,1-f)(1,2,4)triazin-4(1H)-one, 97%, 2-chloro-1h,4h-pyrrolo(2,1-f)(1,2,4)triazin-4-one, 2-Chloropyrrolo[2,1-f][1,2,4]triazin-4(1H)-one 95%, 2-Chloropyrrolo[2,1-f][1,2,4]triazin-4(1H)-one, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 500mg.
2-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 1613751-69-1) is a chemical compound with the molecular formula C6H4ClN3O and a molecular weight of 169.57 g/mol. IUPAC name: 2-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: FWRBBSRLGVCMIR-UHFFFAOYSA-N.
| Molecular formula | C6H4ClN3O |
|---|---|
| Molecular weight | 169.57 g/mol |
| IUPAC name | 2-chloro-3H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | FWRBBSRLGVCMIR-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=O)NC(=N2)Cl |
Computed by PubChem (NCBI)