CAS 16139-79-0 appears in our catalog under these names: Diphenylphosphonoacetic acid ethyl ester, 96%, Ethyl Diphenylphosphonoacetate (Horner–Emmons Reagent), Ethyl Diphenylphosphonoacetate [Horner-Emmons Reagent], >96.0%(GC), Ethyl 2-(diphenoxyphosphoryl)acetate 95%, Ethyl 2-(Diphenoxyphosphoryl)Acetate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 25g, 200mg, 100g.
Ethyl 2-diphenoxyphosphorylacetate (CAS 16139-79-0) is a chemical compound with the molecular formula C16H17O5P and a molecular weight of 320.28 g/mol. IUPAC name: ethyl 2-diphenoxyphosphorylacetate. InChIKey: UQMFCYBSUVRGNU-UHFFFAOYSA-N.
| Molecular formula | C16H17O5P |
|---|---|
| Molecular weight | 320.28 g/mol |
| IUPAC name | ethyl 2-diphenoxyphosphorylacetate |
| InChIKey | UQMFCYBSUVRGNU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CP(=O)(OC1=CC=CC=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)