Products 161405-23-8

CAS 161405-23-8 is the registry number for 6-Benzyloxy-4-chloro-quinoline-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-chloro-6-phenylmethoxyquinoline-3-carboxylate (CAS 161405-23-8) is a chemical compound with the molecular formula C19H16ClNO3 and a molecular weight of 341.8 g/mol. IUPAC name: ethyl 4-chloro-6-phenylmethoxyquinoline-3-carboxylate. InChIKey: ZGVRJBFDLWDDRK-UHFFFAOYSA-N.

Identity
Molecular formulaC19H16ClNO3
Molecular weight341.8 g/mol
IUPAC nameethyl 4-chloro-6-phenylmethoxyquinoline-3-carboxylate
InChIKeyZGVRJBFDLWDDRK-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN=C2C=CC(=CC2=C1Cl)OCC3=CC=CC=C3

Computed by PubChem (NCBI)