CAS 161406-19-5 is the registry number for 4-Aminobenzoic Acid-13C6. Offered by: TRC. Available pack sizes: 25mg.
4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 161406-19-5) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 143.092 g/mol. IUPAC name: 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: ALYNCZNDIQEVRV-IDEBNGHGSA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 143.092 g/mol |
| IUPAC name | 4-amino(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | ALYNCZNDIQEVRV-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13CH]=[13C]1C(=O)O)N |
Computed by PubChem (NCBI)