CAS 16142-09-9 appears in our catalog under these names: (S)-2,6-Diamino-hexanoic acid benzyl ester dihydrochloride, 95%, (S)–Benzyl 2,6–diaminohexanoate dihydrochloride, H-Lys-OBzl·2HCl 97%, (S)-Benzyl 2,6-diaminohexanoate dihydrochloride, 97%, 97%, (S)-Benzyl 2,6-diamino-hexanoate dihydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 25g, 100g, 10g.
Benzyl (2S)-2,6-diaminohexanoate;dihydrochloride (CAS 16142-09-9) is a chemical compound with the molecular formula C13H22Cl2N2O2 and a molecular weight of 309.2 g/mol. IUPAC name: benzyl (2S)-2,6-diaminohexanoate;dihydrochloride. InChIKey: JKVQJCVWGBIKPE-LTCKWSDVSA-N.
| Molecular formula | C13H22Cl2N2O2 |
|---|---|
| Molecular weight | 309.2 g/mol |
| IUPAC name | benzyl (2S)-2,6-diaminohexanoate;dihydrochloride |
| InChIKey | JKVQJCVWGBIKPE-LTCKWSDVSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CCCCN)N.Cl.Cl |
Computed by PubChem (NCBI)