CAS 16142-27-1 appears in our catalog under these names: SIN–1 chloride, SIN-1, Hydrochloride 1PC X 20MG, Molsidomine EP Impurity A HCl (3-(Morpholin-4-yl)-Sydnonimine HCl, Linsidomine HCl), Linsidomine HCl, 98%, Linsidomine hydrochloride/ 99.81% (existing batch purity). Offered by: GLPBio, Sigma-Aldrich, Chemat Brand, AmBeed, TargetMol. Available pack sizes: 10mg, 100mg, 50mg, 500mg, 20MG, on request, 25mg, 5mg.
3-morpholin-4-yloxadiazol-3-ium-5-amine chloride (CAS 16142-27-1) is a chemical compound with the molecular formula C6H11ClN4O2 and a molecular weight of 206.63 g/mol. IUPAC name: 3-morpholin-4-yloxadiazol-3-ium-5-amine chloride. InChIKey: ZRFWHHCXSSACAW-UHFFFAOYSA-M.
| Molecular formula | C6H11ClN4O2 |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 3-morpholin-4-yloxadiazol-3-ium-5-amine chloride |
| InChIKey | ZRFWHHCXSSACAW-UHFFFAOYSA-M |
| SMILES | C1COCCN1[N+]2=NOC(=C2)N.[Cl-] |
Computed by PubChem (NCBI)