Products 16142-33-9

CAS 16142-33-9 is the registry number for 3-Dimethylaminosydnonimine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

3-N,3-N-dimethyloxadiazol-3-ium-3,5-diamine chloride (CAS 16142-33-9) is a chemical compound with the molecular formula C4H9ClN4O and a molecular weight of 164.59 g/mol. IUPAC name: 3-N,3-N-dimethyloxadiazol-3-ium-3,5-diamine chloride. InChIKey: HUGANTMXIYFMCP-UHFFFAOYSA-M.

Identity
Molecular formulaC4H9ClN4O
Molecular weight164.59 g/mol
IUPAC name3-N,3-N-dimethyloxadiazol-3-ium-3,5-diamine chloride
InChIKeyHUGANTMXIYFMCP-UHFFFAOYSA-M
SMILESCN(C)[N+]1=NOC(=C1)N.[Cl-]

Computed by PubChem (NCBI)