CAS 16142-33-9 is the registry number for 3-Dimethylaminosydnonimine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-N,3-N-dimethyloxadiazol-3-ium-3,5-diamine chloride (CAS 16142-33-9) is a chemical compound with the molecular formula C4H9ClN4O and a molecular weight of 164.59 g/mol. IUPAC name: 3-N,3-N-dimethyloxadiazol-3-ium-3,5-diamine chloride. InChIKey: HUGANTMXIYFMCP-UHFFFAOYSA-M.
| Molecular formula | C4H9ClN4O |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 3-N,3-N-dimethyloxadiazol-3-ium-3,5-diamine chloride |
| InChIKey | HUGANTMXIYFMCP-UHFFFAOYSA-M |
| SMILES | CN(C)[N+]1=NOC(=C1)N.[Cl-] |
Computed by PubChem (NCBI)