CAS 1614245-70-3 appears in our catalog under these names: PF-06372865, 98%, Darigabat/ 98.89% (existing batch purity), PF–06372865, PF 06372865, PF-06372865. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 100 mg.
7-ethyl-4-[3-(4-ethylsulfonyl-2-methoxyphenyl)-4-fluorophenyl]imidazo[4,5-c]pyridazine (CAS 1614245-70-3) is a chemical compound with the molecular formula C22H21FN4O3S and a molecular weight of 440.5 g/mol. IUPAC name: 7-ethyl-4-[3-(4-ethylsulfonyl-2-methoxyphenyl)-4-fluorophenyl]imidazo[4,5-c]pyridazine. InChIKey: PTTQXDBPTFOCMT-UHFFFAOYSA-N.
| Molecular formula | C22H21FN4O3S |
|---|---|
| Molecular weight | 440.5 g/mol |
| IUPAC name | 7-ethyl-4-[3-(4-ethylsulfonyl-2-methoxyphenyl)-4-fluorophenyl]imidazo[4,5-c]pyridazine |
| InChIKey | PTTQXDBPTFOCMT-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1N=NC=C2C3=CC(=C(C=C3)F)C4=C(C=C(C=C4)S(=O)(=O)CC)OC |
Computed by PubChem (NCBI)