Products 1614253-58-5
CAS 1614253-58-5 is the registry number for [18F]-Labeled L-dopa precursor. Offered by: MedChemExpress. Available pack sizes: Get quote.
Tert-butyl (2S)-3-[5-formyl-4-(methoxymethoxy)-2-nitrophenyl]-2-(tritylamino)propanoate (CAS 1614253-58-5) is a chemical compound with the molecular formula C35H36N2O7 and a molecular weight of 596.7 g/mol. IUPAC name: tert-butyl (2S)-3-[5-formyl-4-(methoxymethoxy)-2-nitrophenyl]-2-(tritylamino)propanoate. InChIKey: VVJCOYOABXDYEA-PMERELPUSA-N.
| Molecular formula | C35H36N2O7 |
|---|---|
| Molecular weight | 596.7 g/mol |
| IUPAC name | tert-butyl (2S)-3-[5-formyl-4-(methoxymethoxy)-2-nitrophenyl]-2-(tritylamino)propanoate |
| InChIKey | VVJCOYOABXDYEA-PMERELPUSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CC1=CC(=C(C=C1[N+](=O)[O-])OCOC)C=O)NC(C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
[18F]-Labeled L-dopa precursor, orb1983147