CAS 1614256-81-3 is the registry number for tert-Butyl ((1R,5S,6r)-3-azabicyclo(3.1.1)heptan-6-yl)carbamate, 97+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[(1R,5S)-3-azabicyclo[3.1.1]heptan-6-yl]carbamate (CAS 1614256-81-3) is a chemical compound with the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. IUPAC name: tert-butyl N-[(1R,5S)-3-azabicyclo[3.1.1]heptan-6-yl]carbamate. InChIKey: WULUIRLXYWAJQJ-JVHMLUBASA-N.
| Molecular formula | C11H20N2O2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | tert-butyl N-[(1R,5S)-3-azabicyclo[3.1.1]heptan-6-yl]carbamate |
| InChIKey | WULUIRLXYWAJQJ-JVHMLUBASA-N |
| SMILES | CC(C)(C)OC(=O)NC1[C@@H]2C[C@H]1CNC2 |
Computed by PubChem (NCBI)