CAS 1615-92-5 is the registry number for Hop-21-ene. Offered by: TRC. Available pack sizes: 50mg.
Hop-21(22)-ene is a triterpene consisting of hopane having a C=C double bond at the 21-position. It has a role as a bacterial metabolite. It derives from a hydride of a hopane.
Source: ChEBI
| Molecular formula | C30H50 |
|---|---|
| Molecular weight | 410.7 g/mol |
| IUPAC name | (3aR,5aR,5bR,7aS,11aS,11bR,13aR,13bS)-5a,5b,8,8,11a,13b-hexamethyl-3-propan-2-ylidene-2,3a,4,5,6,7,7a,9,10,11,11b,12,13,13a-tetradecahydro-1H-cyclopenta[a]chrysene |
| InChIKey | CBZFLMNNXKRPHN-DRTOFSRZSA-N |
| SMILES | CC(=C1CC[C@]2([C@H]1CC[C@@]3([C@@H]2CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C)C)C)C |
Computed by PubChem (NCBI)