CAS 1615710-02-5 is the registry number for Diethyl (2-bromo-4-methylphenyl)phosphonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-1-diethoxyphosphoryl-4-methylbenzene (CAS 1615710-02-5) is a chemical compound with the molecular formula C11H16BrO3P and a molecular weight of 307.12 g/mol. IUPAC name: 2-bromo-1-diethoxyphosphoryl-4-methylbenzene. InChIKey: OQYNMYUCIXXMJY-UHFFFAOYSA-N.
| Molecular formula | C11H16BrO3P |
|---|---|
| Molecular weight | 307.12 g/mol |
| IUPAC name | 2-bromo-1-diethoxyphosphoryl-4-methylbenzene |
| InChIKey | OQYNMYUCIXXMJY-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(C1=C(C=C(C=C1)C)Br)OCC |
Computed by PubChem (NCBI)