CAS 161605-73-8 appears in our catalog under these names: Zk 200775, 95%, Fanapanel, ZK 200775, P-[[3,4-Dihydro-7-(4-morpholinyl)-2,3-dioxo-6-(trifluoromethyl)-1(2H)-quinoxalinyl]methyl]phosphonic acid, 99%, 99%, Fanapanel, 99.51%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 2mg, 1mg, 100mg, 10 mg.
[7-morpholin-4-yl-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid (CAS 161605-73-8) is a chemical compound with the molecular formula C14H15F3N3O6P and a molecular weight of 409.25 g/mol. IUPAC name: [7-morpholin-4-yl-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid. InChIKey: WZMQMKNCWDCCMT-UHFFFAOYSA-N.
| Molecular formula | C14H15F3N3O6P |
|---|---|
| Molecular weight | 409.25 g/mol |
| IUPAC name | [7-morpholin-4-yl-2,3-dioxo-6-(trifluoromethyl)-4H-quinoxalin-1-yl]methylphosphonic acid |
| InChIKey | WZMQMKNCWDCCMT-UHFFFAOYSA-N |
| SMILES | C1COCCN1C2=CC3=C(C=C2C(F)(F)F)NC(=O)C(=O)N3CP(=O)(O)O |
Computed by PubChem (NCBI)