CAS 16162-28-0 appears in our catalog under these names: Benzo(1,2–d:4,5–d')bis(thiazole)–2,6–diamine, Benzo[1,2-d:4,5-d']bis(thiazole)-2,6-diamine 95%, Benzo[1,2-d:4,5-d'']bisthiazole-2,6-diamine, 97%, 97%, Benzo[1,2-d:4,5-d']bis(thiazole)-2,6-diamine, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 2.5g.
[1,3]thiazolo[5,4-f][1,3]benzothiazole-2,6-diamine (CAS 16162-28-0) is a chemical compound with the molecular formula C8H6N4S2 and a molecular weight of 222.3 g/mol. IUPAC name: [1,3]thiazolo[5,4-f][1,3]benzothiazole-2,6-diamine. InChIKey: ZLPFCTALWYMMQL-UHFFFAOYSA-N.
| Molecular formula | C8H6N4S2 |
|---|---|
| Molecular weight | 222.3 g/mol |
| IUPAC name | [1,3]thiazolo[5,4-f][1,3]benzothiazole-2,6-diamine |
| InChIKey | ZLPFCTALWYMMQL-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC3=C1SC(=N3)N)SC(=N2)N |
Computed by PubChem (NCBI)