Products 1616253-26-9

CAS 1616253-26-9 is the registry number for I-AMB. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 10mg, 25mg.

Structural formula: {0} (CAS {1})

Methyl 2-[[1-(5-fluoropentyl)indole-3-carbonyl]amino]-3-methylbutanoate (CAS 1616253-26-9) is a chemical compound with the molecular formula C20H27FN2O3 and a molecular weight of 362.4 g/mol. IUPAC name: methyl 2-[[1-(5-fluoropentyl)indole-3-carbonyl]amino]-3-methylbutanoate. InChIKey: JFXASAFVUQVGEW-UHFFFAOYSA-N.

Identity
Molecular formulaC20H27FN2O3
Molecular weight362.4 g/mol
IUPAC namemethyl 2-[[1-(5-fluoropentyl)indole-3-carbonyl]amino]-3-methylbutanoate
InChIKeyJFXASAFVUQVGEW-UHFFFAOYSA-N
SMILESCC(C)C(C(=O)OC)NC(=O)C1=CN(C2=CC=CC=C21)CCCCCF

Computed by PubChem (NCBI)