Products 161638-38-6
CAS 161638-38-6 is the registry number for Isopropyl Chloroformate-d7. Offered by: TRC. Available pack sizes: 250mg.
1,1,1,2,3,3,3-heptadeuteriopropan-2-yl carbonochloridate (CAS 161638-38-6) is a chemical compound with the molecular formula C4H7ClO2 and a molecular weight of 129.59 g/mol. IUPAC name: 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl carbonochloridate. InChIKey: IVRIRQXJSNCSPQ-YYWVXINBSA-N.
| Molecular formula | C4H7ClO2 |
|---|---|
| Molecular weight | 129.59 g/mol |
| IUPAC name | 1,1,1,2,3,3,3-heptadeuteriopropan-2-yl carbonochloridate |
| InChIKey | IVRIRQXJSNCSPQ-YYWVXINBSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])OC(=O)Cl |
Computed by PubChem (NCBI)