CAS 1616466-83-1 is the registry number for rel-(4aR,7aR)-6,6-Difluorooctahydrocyclopenta[b][1,4]oxazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4aR,7aR)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine (CAS 1616466-83-1) is a chemical compound with the molecular formula C7H11F2NO and a molecular weight of 163.16 g/mol. IUPAC name: (4aR,7aR)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine. InChIKey: JXGBZSGUAKQWCW-PHDIDXHHSA-N.
| Molecular formula | C7H11F2NO |
|---|---|
| Molecular weight | 163.16 g/mol |
| IUPAC name | (4aR,7aR)-6,6-difluoro-3,4,4a,5,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine |
| InChIKey | JXGBZSGUAKQWCW-PHDIDXHHSA-N |
| SMILES | C1CO[C@@H]2CC(C[C@H]2N1)(F)F |
Computed by PubChem (NCBI)