Products 1616592-61-0
CAS 1616592-61-0 is the registry number for Erythrinin G. Offered by: Biosynth, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, Get quote.
(3R)-3,5-dihydroxy-9-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one (CAS 1616592-61-0) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: (3R)-3,5-dihydroxy-9-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one. InChIKey: HFVFEMFAVPWVDX-MRXNPFEDSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (3R)-3,5-dihydroxy-9-(4-hydroxyphenyl)-2,2-dimethyl-3,4-dihydropyrano[2,3-f]chromen-10-one |
| InChIKey | HFVFEMFAVPWVDX-MRXNPFEDSA-N |
| SMILES | CC1([C@@H](CC2=C(O1)C3=C(C=C2O)OC=C(C3=O)C4=CC=C(C=C4)O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Erythrinin G, orb1682627