CAS 1616593-18-0 is the registry number for 5-Bromo-2-(quinolin-6-yl)benzo[d]oxazole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
5-bromo-2-quinolin-6-yl-1,3-benzoxazole (CAS 1616593-18-0) is a chemical compound with the molecular formula C16H9BrN2O and a molecular weight of 325.16 g/mol. IUPAC name: 5-bromo-2-quinolin-6-yl-1,3-benzoxazole. InChIKey: WXNAFPNHHHVGHU-UHFFFAOYSA-N.
| Molecular formula | C16H9BrN2O |
|---|---|
| Molecular weight | 325.16 g/mol |
| IUPAC name | 5-bromo-2-quinolin-6-yl-1,3-benzoxazole |
| InChIKey | WXNAFPNHHHVGHU-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)C3=NC4=C(O3)C=CC(=C4)Br)N=C1 |
Computed by PubChem (NCBI)