Products 1616607-36-3
CAS 1616607-36-3 appears in our catalog under these names: (±)7(8)-EpDTE, (±)7(8)–EpDTE, (±)7(8)-Epdote. Offered by: TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 25ug, 50ug, 100ug, 100μg, 25μg, 50μg, 1mg, 50 μg.
6-[(2S,3R)-3-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]oxiran-2-yl]hexanoic acid (CAS 1616607-36-3) is a chemical compound with the molecular formula C22H34O3 and a molecular weight of 346.5 g/mol. IUPAC name: 6-[(2S,3R)-3-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]oxiran-2-yl]hexanoic acid. InChIKey: BHODHHIOZSFCBJ-OWLXCJBYSA-N.
| Molecular formula | C22H34O3 |
|---|---|
| Molecular weight | 346.5 g/mol |
| IUPAC name | 6-[(2S,3R)-3-[(2Z,5Z,8Z,11Z)-tetradeca-2,5,8,11-tetraenyl]oxiran-2-yl]hexanoic acid |
| InChIKey | BHODHHIOZSFCBJ-OWLXCJBYSA-N |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C[C@@H]1[C@@H](O1)CCCCCC(=O)O |
Computed by PubChem (NCBI)