Products 1616622-15-1
CAS 1616622-15-1 is the registry number for Oxanthroquinone G01. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
Ethyl 8-hydroxy-3-methoxy-1,7-dimethyl-9,10-dioxoanthracene-2-carboxylate (CAS 1616622-15-1) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: ethyl 8-hydroxy-3-methoxy-1,7-dimethyl-9,10-dioxoanthracene-2-carboxylate. InChIKey: NWSATONEZZIFDE-UHFFFAOYSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | ethyl 8-hydroxy-3-methoxy-1,7-dimethyl-9,10-dioxoanthracene-2-carboxylate |
| InChIKey | NWSATONEZZIFDE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C2C(=C1C)C(=O)C3=C(C2=O)C=CC(=C3O)C)OC |
Computed by PubChem (NCBI)
Synonyms:
Oxanthroquinone G01