CAS 1616632-49-5 is the registry number for 9-Bromo-6H-benzofuro[2,3-b]indole, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
9-bromo-6H-[1]benzofuro[2,3-b]indole (CAS 1616632-49-5) is a chemical compound with the molecular formula C14H8BrNO and a molecular weight of 286.12 g/mol. IUPAC name: 9-bromo-6H-[1]benzofuro[2,3-b]indole. InChIKey: ZBVGIXOXFOUUNF-UHFFFAOYSA-N.
| Molecular formula | C14H8BrNO |
|---|---|
| Molecular weight | 286.12 g/mol |
| IUPAC name | 9-bromo-6H-[1]benzofuro[2,3-b]indole |
| InChIKey | ZBVGIXOXFOUUNF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)NC4=C3C=C(C=C4)Br |
Computed by PubChem (NCBI)