CAS 1616678-32-0 appears in our catalog under these names: Oxazosulfyl, Oxazosulfyl, 98%, Oxazosulfyl, 99.66%. Offered by: TRC, AmBeed, Dr. Ehrenstorfer, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 5mg, 10mM/1mL, 25 mg, 100 mg, 10 mg, 50 mg.
2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1,3-benzoxazole (CAS 1616678-32-0) is a chemical compound with the molecular formula C15H11F3N2O5S2 and a molecular weight of 420.4 g/mol. IUPAC name: 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1,3-benzoxazole. InChIKey: PTQBEFQWTBZMED-UHFFFAOYSA-N.
| Molecular formula | C15H11F3N2O5S2 |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | 2-(3-ethylsulfonyl-2-pyridinyl)-5-(trifluoromethylsulfonyl)-1,3-benzoxazole |
| InChIKey | PTQBEFQWTBZMED-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1=C(N=CC=C1)C2=NC3=C(O2)C=CC(=C3)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)