CAS 1616841-73-6 is the registry number for 2-(4-Bromophenyl)-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-bromophenyl)-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine (CAS 1616841-73-6) is a chemical compound with the molecular formula C25H22BrN3 and a molecular weight of 444.4 g/mol. IUPAC name: 2-(4-bromophenyl)-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine. InChIKey: YZVACRNKRFPNNU-UHFFFAOYSA-N.
| Molecular formula | C25H22BrN3 |
|---|---|
| Molecular weight | 444.4 g/mol |
| IUPAC name | 2-(4-bromophenyl)-4,6-bis(3,5-dimethylphenyl)-1,3,5-triazine |
| InChIKey | YZVACRNKRFPNNU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2=NC(=NC(=N2)C3=CC=C(C=C3)Br)C4=CC(=CC(=C4)C)C)C |
Computed by PubChem (NCBI)