CAS 1617494-49-1 appears in our catalog under these names: 9-(4-(4-Phenylquinolin-2-yl)phenyl)-9H-carbazole, 99%, Poly((9,9-dioctylfluorenyl-2,7-diyl)-alt-(2,6-pyridine)). Offered by: Lumtec, Chemat Brand. Available pack sizes: 1g, 2g, on request.
9-[4-(4-phenylquinolin-2-yl)phenyl]carbazole (CAS 1617494-49-1) is a chemical compound with the molecular formula C33H22N2 and a molecular weight of 446.5 g/mol. IUPAC name: 9-[4-(4-phenylquinolin-2-yl)phenyl]carbazole. InChIKey: NZERMBMPWIYRBP-UHFFFAOYSA-N.
| Molecular formula | C33H22N2 |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | 9-[4-(4-phenylquinolin-2-yl)phenyl]carbazole |
| InChIKey | NZERMBMPWIYRBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NC3=CC=CC=C32)C4=CC=C(C=C4)N5C6=CC=CC=C6C7=CC=CC=C75 |
Computed by PubChem (NCBI)