CAS 1618078-75-3 is the registry number for trans Resveratrol-3,5-disulfate Disodium Salt. Offered by: TRC. Available pack sizes: 100mg.
Disodium;[3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-sulfonatooxyphenyl] sulfate (CAS 1618078-75-3) is a chemical compound with the molecular formula C14H10Na2O9S2 and a molecular weight of 432.3 g/mol. IUPAC name: disodium;[3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-sulfonatooxyphenyl] sulfate. InChIKey: ODTUSYINNIIPRB-SEPHDYHBSA-L.
| Molecular formula | C14H10Na2O9S2 |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | disodium;[3-[(E)-2-(4-hydroxyphenyl)ethenyl]-5-sulfonatooxyphenyl] sulfate |
| InChIKey | ODTUSYINNIIPRB-SEPHDYHBSA-L |
| SMILES | C1=CC(=CC=C1/C=C/C2=CC(=CC(=C2)OS(=O)(=O)[O-])OS(=O)(=O)[O-])O.[Na+].[Na+] |
Computed by PubChem (NCBI)