CAS 1618107-96-2 appears in our catalog under these names: 5-(5-Chloro-1-(2-fluorophenyl)-2-oxopentyl)-4,5,6,7-tetrahydrothieno(3,2-c)pyridin-2-yl Acetate Hydrochloride, Prasugrel EP Impurity E HCl, Prasugrel Impurity 7, Prasugrel impurity 1. Offered by: TRC, Chemat Brand, Hubei YoungXin, MedChemExpress. Available pack sizes: 50mg, on request, 10mg, 25mg, 100mg, 200mg, Get quote.
[5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate;hydrochloride (CAS 1618107-96-2) is a chemical compound with the molecular formula C20H22Cl2FNO3S and a molecular weight of 446.4 g/mol. IUPAC name: [5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate;hydrochloride. InChIKey: YUWLEAAJIXVEKA-UHFFFAOYSA-N.
| Molecular formula | C20H22Cl2FNO3S |
|---|---|
| Molecular weight | 446.4 g/mol |
| IUPAC name | [5-[5-chloro-1-(2-fluorophenyl)-2-oxopentyl]-6,7-dihydro-4H-thieno[3,2-c]pyridin-2-yl] acetate;hydrochloride |
| InChIKey | YUWLEAAJIXVEKA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(S1)CCN(C2)C(C3=CC=CC=C3F)C(=O)CCCCl.Cl |
Computed by PubChem (NCBI)