CAS 161848-60-8 appears in our catalog under these names: 5-BrUTP sodium salt, 98%, 5-BrUTP sodium salt, 5-Bromouridine 5²-triphosphate sodium salt, 5-BROMOURIDINE 5'-TRIPHOSPHATE SODIUM, .-BROMOURIDINE 5'-TRIPHOSPHATE SODIUM. Offered by: AmBeed, TargetMol, Biosynth, Sigma-Aldrich, MedChemExpress. Available pack sizes: 25mg, 10mg, 2mg, 50mg, 100mg, 5MG, 5 mg, 10 mg.
CAS 161848-60-8 identifies a chemical compound with the molecular formula C9H14BrN2NaO15P3 and a molecular weight of 586.03 g/mol. InChIKey: AQAYOSVTWCFXNA-HCXTZZCQSA-N.
| Molecular formula | C9H14BrN2NaO15P3 |
|---|---|
| Molecular weight | 586.03 g/mol |
| InChIKey | AQAYOSVTWCFXNA-HCXTZZCQSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O)O)Br.[Na] |
Computed by PubChem (NCBI)