CAS 161967-81-3 appears in our catalog under these names: Grepafloxacin hydrochloride, Grepafloxacin (hydrochloride), 99.23%, 99.23%, Grepafloxacin (hydrochloride), 99.55%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25 mg, 5 mg, 10mM/1mL, 50 mg, 10 mg.
1-cyclopropyl-6-fluoro-5-methyl-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride (CAS 161967-81-3) is a chemical compound with the molecular formula C19H23ClFN3O3 and a molecular weight of 395.9 g/mol. IUPAC name: 1-cyclopropyl-6-fluoro-5-methyl-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride. InChIKey: IEPMBYOIQGCVHO-UHFFFAOYSA-N.
| Molecular formula | C19H23ClFN3O3 |
|---|---|
| Molecular weight | 395.9 g/mol |
| IUPAC name | 1-cyclopropyl-6-fluoro-5-methyl-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | IEPMBYOIQGCVHO-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C2=C(C(=C3C(=C2)N(C=C(C3=O)C(=O)O)C4CC4)C)F.Cl |
Computed by PubChem (NCBI)