CAS 16197-92-5 is the registry number for (R)-1-phenylethyl acetate 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
[(1R)-1-phenylethyl] acetate (CAS 16197-92-5) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: [(1R)-1-phenylethyl] acetate. InChIKey: QUMXDOLUJCHOAY-MRVPVSSYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | [(1R)-1-phenylethyl] acetate |
| InChIKey | QUMXDOLUJCHOAY-MRVPVSSYSA-N |
| SMILES | C[C@H](C1=CC=CC=C1)OC(=O)C |
Computed by PubChem (NCBI)