Products 16198-01-9
CAS 16198-01-9 appears in our catalog under these names: (+)-Catechin pentaacetate/ 97%, (+)-Catechin pentaacetate, Catechin pentaacetate. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 5mg, 1 mg, 1mg.
[(2R,3S)-5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate (CAS 16198-01-9) is a chemical compound with the molecular formula C25H24O11 and a molecular weight of 500.4 g/mol. IUPAC name: [(2R,3S)-5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate. InChIKey: BKYWAYNSDFXIPL-LOSJGSFVSA-N.
| Molecular formula | C25H24O11 |
|---|---|
| Molecular weight | 500.4 g/mol |
| IUPAC name | [(2R,3S)-5,7-diacetyloxy-2-(3,4-diacetyloxyphenyl)-3,4-dihydro-2H-chromen-3-yl] acetate |
| InChIKey | BKYWAYNSDFXIPL-LOSJGSFVSA-N |
| SMILES | CC(=O)O[C@H]1CC2=C(C=C(C=C2OC(=O)C)OC(=O)C)O[C@@H]1C3=CC(=C(C=C3)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)