Products 1619884-75-1
CAS 1619884-75-1 is the registry number for MAO-B-IN-35. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(3,4-dichlorophenyl)-1-(1H-indazol-5-yl)methanimine (CAS 1619884-75-1) is a chemical compound with the molecular formula C14H9Cl2N3 and a molecular weight of 290.1 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-1-(1H-indazol-5-yl)methanimine. InChIKey: ODHPFVFFVLSYBF-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2N3 |
|---|---|
| Molecular weight | 290.1 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-1-(1H-indazol-5-yl)methanimine |
| InChIKey | ODHPFVFFVLSYBF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=NC3=CC(=C(C=C3)Cl)Cl)C=NN2 |
Computed by PubChem (NCBI)