CAS 1619929-59-7 is the registry number for AKT-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-phenyltriazol-1-yl)-piperidin-1-ylmethanone (CAS 1619929-59-7) is a chemical compound with the molecular formula C14H16N4O and a molecular weight of 256.30 g/mol. IUPAC name: (4-phenyltriazol-1-yl)-piperidin-1-ylmethanone. InChIKey: MKCZINLPKDSDKH-UHFFFAOYSA-N.
| Molecular formula | C14H16N4O |
|---|---|
| Molecular weight | 256.30 g/mol |
| IUPAC name | (4-phenyltriazol-1-yl)-piperidin-1-ylmethanone |
| InChIKey | MKCZINLPKDSDKH-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C(=O)N2C=C(N=N2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)