Products 1619994-69-2
CAS 1619994-69-2 appears in our catalog under these names: Bromosporine, >95% (HPLC), Bromosporine, Bromosporine/ 99.65% (existing batch purity), Bromosporine 98%, Bromosporine, 98%, 98%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 10mg, 1mg, 5mg, 50mg, 25mg, 100mg, 500mg, 250mg.
Ethyl N-[6-[3-(methanesulfonamido)-4-methylphenyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate (CAS 1619994-69-2) is a chemical compound with the molecular formula C17H20N6O4S and a molecular weight of 404.4 g/mol. IUPAC name: ethyl N-[6-[3-(methanesulfonamido)-4-methylphenyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate. InChIKey: UYBRROMMFMPJAN-UHFFFAOYSA-N.
| Molecular formula | C17H20N6O4S |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | ethyl N-[6-[3-(methanesulfonamido)-4-methylphenyl]-3-methyl-[1,2,4]triazolo[4,3-b]pyridazin-8-yl]carbamate |
| InChIKey | UYBRROMMFMPJAN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC1=CC(=NN2C1=NN=C2C)C3=CC(=C(C=C3)C)NS(=O)(=O)C |
Computed by PubChem (NCBI)