Products 16200-73-0

CAS 16200-73-0 is the registry number for 3-Chloro-3-methylcyclobutane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-chloro-3-methylcyclobutane-1-carboxylic acid (CAS 16200-73-0) is a chemical compound with the molecular formula C6H9ClO2 and a molecular weight of 148.59 g/mol. IUPAC name: 3-chloro-3-methylcyclobutane-1-carboxylic acid. InChIKey: HCBGRXCAOORSOL-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9ClO2
Molecular weight148.59 g/mol
IUPAC name3-chloro-3-methylcyclobutane-1-carboxylic acid
InChIKeyHCBGRXCAOORSOL-UHFFFAOYSA-N
SMILESCC1(CC(C1)C(=O)O)Cl

Computed by PubChem (NCBI)