Products 1620203-63-5
CAS 1620203-63-5 is the registry number for VU0431316. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-N-(6-pyrimidin-5-yloxypyrazin-2-yl)pyridine-2-carboxamide (CAS 1620203-63-5) is a chemical compound with the molecular formula C14H9ClN6O2 and a molecular weight of 328.71 g/mol. IUPAC name: 4-chloro-N-(6-pyrimidin-5-yloxypyrazin-2-yl)pyridine-2-carboxamide. InChIKey: UEUUWJVQGWZIJY-UHFFFAOYSA-N.
| Molecular formula | C14H9ClN6O2 |
|---|---|
| Molecular weight | 328.71 g/mol |
| IUPAC name | 4-chloro-N-(6-pyrimidin-5-yloxypyrazin-2-yl)pyridine-2-carboxamide |
| InChIKey | UEUUWJVQGWZIJY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1Cl)C(=O)NC2=CN=CC(=N2)OC3=CN=CN=C3 |
Computed by PubChem (NCBI)