Products 1620318-81-1
CAS 1620318-81-1 is the registry number for Methyl 2-(6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl)acetate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]acetate (CAS 1620318-81-1) is a chemical compound with the molecular formula C17H22BNO4 and a molecular weight of 315.2 g/mol. IUPAC name: methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]acetate. InChIKey: ZOQSKNMOYHDQHB-UHFFFAOYSA-N.
| Molecular formula | C17H22BNO4 |
|---|---|
| Molecular weight | 315.2 g/mol |
| IUPAC name | methyl 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-3-yl]acetate |
| InChIKey | ZOQSKNMOYHDQHB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C(=CN3)CC(=O)OC |
Computed by PubChem (NCBI)