Products 1620442-30-9
CAS 1620442-30-9 is the registry number for Gamhepathiopine. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(tert-butylamino)-6-(4-methylphenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1620442-30-9) is a chemical compound with the molecular formula C17H19N3OS and a molecular weight of 313.4 g/mol. IUPAC name: 2-(tert-butylamino)-6-(4-methylphenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: CSUDBZWWOWBKQX-UHFFFAOYSA-N.
| Molecular formula | C17H19N3OS |
|---|---|
| Molecular weight | 313.4 g/mol |
| IUPAC name | 2-(tert-butylamino)-6-(4-methylphenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | CSUDBZWWOWBKQX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC3=C(S2)C(=O)NC(=N3)NC(C)(C)C |
Computed by PubChem (NCBI)