CAS 1620482-41-8 is the registry number for 5-(2-Bromo-4-fluorophenoxy)pyrimidine-2,4-diamine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
5-(2-bromo-4-fluorophenoxy)pyrimidine-2,4-diamine (CAS 1620482-41-8) is a chemical compound with the molecular formula C10H8BrFN4O and a molecular weight of 299.10 g/mol. IUPAC name: 5-(2-bromo-4-fluorophenoxy)pyrimidine-2,4-diamine. InChIKey: ITZRFJOYIBVJFT-UHFFFAOYSA-N.
| Molecular formula | C10H8BrFN4O |
|---|---|
| Molecular weight | 299.10 g/mol |
| IUPAC name | 5-(2-bromo-4-fluorophenoxy)pyrimidine-2,4-diamine |
| InChIKey | ITZRFJOYIBVJFT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Br)OC2=CN=C(N=C2N)N |
Computed by PubChem (NCBI)