Products 1620572-54-4

CAS 1620572-54-4 appears in our catalog under these names: 4-Methanesulfonylthiophene-2-sulfonyl chloride, 4-(Methylsulfonyl)thiophene-2-sulfonyl chloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.

4-methylsulfonylthiophene-2-sulfonyl chloride (CAS 1620572-54-4) is a chemical compound with the molecular formula C5H5ClO4S3 and a molecular weight of 260.7 g/mol. IUPAC name: 4-methylsulfonylthiophene-2-sulfonyl chloride. InChIKey: BMGZIKVBFXAUKB-UHFFFAOYSA-N.

Identity
Molecular formulaC5H5ClO4S3
Molecular weight260.7 g/mol
IUPAC name4-methylsulfonylthiophene-2-sulfonyl chloride
InChIKeyBMGZIKVBFXAUKB-UHFFFAOYSA-N
SMILESCS(=O)(=O)C1=CSC(=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)