CAS 1620572-54-4 appears in our catalog under these names: 4-Methanesulfonylthiophene-2-sulfonyl chloride, 4-(Methylsulfonyl)thiophene-2-sulfonyl chloride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
4-methylsulfonylthiophene-2-sulfonyl chloride (CAS 1620572-54-4) is a chemical compound with the molecular formula C5H5ClO4S3 and a molecular weight of 260.7 g/mol. IUPAC name: 4-methylsulfonylthiophene-2-sulfonyl chloride. InChIKey: BMGZIKVBFXAUKB-UHFFFAOYSA-N.
| Molecular formula | C5H5ClO4S3 |
|---|---|
| Molecular weight | 260.7 g/mol |
| IUPAC name | 4-methylsulfonylthiophene-2-sulfonyl chloride |
| InChIKey | BMGZIKVBFXAUKB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CSC(=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)