CAS 1620582-23-1 appears in our catalog under these names: LEI–106, LEI-106, LEI-106, 99.9%. Offered by: GLPBio, TRC, TargetMol, MedChemExpress. Available pack sizes: 1mg, 500mg, 5mg, 10mg, 25mg, 1 mg.
2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl-[(4-phenoxyphenyl)methyl]amino]acetic acid (CAS 1620582-23-1) is a chemical compound with the molecular formula C26H27NO6S and a molecular weight of 481.6 g/mol. IUPAC name: 2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl-[(4-phenoxyphenyl)methyl]amino]acetic acid. InChIKey: FOEGBOXMDBPYEV-UHFFFAOYSA-N.
| Molecular formula | C26H27NO6S |
|---|---|
| Molecular weight | 481.6 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-3,4-dihydrochromen-6-yl)sulfonyl-[(4-phenoxyphenyl)methyl]amino]acetic acid |
| InChIKey | FOEGBOXMDBPYEV-UHFFFAOYSA-N |
| SMILES | CC1(CCC2=C(O1)C=CC(=C2)S(=O)(=O)N(CC3=CC=C(C=C3)OC4=CC=CC=C4)CC(=O)O)C |
Computed by PubChem (NCBI)