Products 1620821-79-5
CAS 1620821-79-5 is the registry number for Methyl 4-(methoxy(methyl)carbamoyl)cubane-1-carboxylate, 97%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
Methyl 4-[methoxy(methyl)carbamoyl]cubane-1-carboxylate (CAS 1620821-79-5) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: methyl 4-[methoxy(methyl)carbamoyl]cubane-1-carboxylate. InChIKey: ZGZPOWYULWLPLV-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | methyl 4-[methoxy(methyl)carbamoyl]cubane-1-carboxylate |
| InChIKey | ZGZPOWYULWLPLV-UHFFFAOYSA-N |
| SMILES | CN(C(=O)C12C3C4C1C5C2C3C45C(=O)OC)OC |
Computed by PubChem (NCBI)