Products 1620837-47-9
CAS 1620837-47-9 appears in our catalog under these names: diMal–O–CH2COOH, diMal-O-CH2COOH, 98%, 98%, diMal-O-CH2COOH, 96.81%, diMal-O-CH2COOH, 98%, diMal-O-CH2COOH 95%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 100mg, 25 mg, 50 mg.
2-[1,3-bis(2,5-dioxopyrrol-1-yl)propan-2-yloxy]acetic acid (CAS 1620837-47-9) is a chemical compound with the molecular formula C13H12N2O7 and a molecular weight of 308.24 g/mol. IUPAC name: 2-[1,3-bis(2,5-dioxopyrrol-1-yl)propan-2-yloxy]acetic acid. InChIKey: JREDLPVQALHAIP-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O7 |
|---|---|
| Molecular weight | 308.24 g/mol |
| IUPAC name | 2-[1,3-bis(2,5-dioxopyrrol-1-yl)propan-2-yloxy]acetic acid |
| InChIKey | JREDLPVQALHAIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CC(CN2C(=O)C=CC2=O)OCC(=O)O |
Computed by PubChem (NCBI)