CAS 162084-62-0 is the registry number for Ethyl (1R,2S)-2-(((methylthio)carbonothioyl)oxy)cyclopentane-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Cis-ethyl (1R,2S)-2-methylsulfanylcarbothioyloxycyclopentane-1-carboxylate (CAS 162084-62-0) is a chemical compound with the molecular formula C10H16O3S2 and a molecular weight of 248.4 g/mol. IUPAC name: cis-ethyl (1R,2S)-2-methylsulfanylcarbothioyloxycyclopentane-1-carboxylate. InChIKey: CBBCDFAGFVLWBA-SFYZADRCSA-N.
| Molecular formula | C10H16O3S2 |
|---|---|
| Molecular weight | 248.4 g/mol |
| IUPAC name | cis-ethyl (1R,2S)-2-methylsulfanylcarbothioyloxycyclopentane-1-carboxylate |
| InChIKey | CBBCDFAGFVLWBA-SFYZADRCSA-N |
| SMILES | CCOC(=O)[C@@H]1CCC[C@@H]1OC(=S)SC |
Computed by PubChem (NCBI)