CAS 162088-91-7 appears in our catalog under these names: 2’-Nitrophenyl 2,3-Di-O-acetyl-Beta-D-xylopyranoside, >95% (HPLC), 2-Nitrophenyl 2,3-di-O-acetyl-b-D-xylopyranoside. Offered by: TRC, Biosynth. Available pack sizes: 5mg, 2mg, 10mg.
[(2S,3R,4S,5R)-3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate (CAS 162088-91-7) is a chemical compound with the molecular formula C15H17NO9 and a molecular weight of 355.30 g/mol. IUPAC name: [(2S,3R,4S,5R)-3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate. InChIKey: OPXWOTRGXPBRCG-BEAPCOKYSA-N.
| Molecular formula | C15H17NO9 |
|---|---|
| Molecular weight | 355.30 g/mol |
| IUPAC name | [(2S,3R,4S,5R)-3-acetyloxy-5-hydroxy-2-(2-nitrophenoxy)oxan-4-yl] acetate |
| InChIKey | OPXWOTRGXPBRCG-BEAPCOKYSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H](CO[C@H]([C@@H]1OC(=O)C)OC2=CC=CC=C2[N+](=O)[O-])O |
Computed by PubChem (NCBI)