CAS 1620882-90-7 appears in our catalog under these names: 2–Butenyl(di–tert–butyl)phosphine, 2-Buten-1-ylbis(1,1-dimethylethyl)phosphine, ≥98%, 40% in xylene, ≥98%, 40% in xylene. Offered by: GLPBio, Chemat. Available pack sizes: 200mg, 1g, 5g.
[(E)-but-2-enyl]-ditert-butylphosphane (CAS 1620882-90-7) is a chemical compound with the molecular formula C12H25P and a molecular weight of 200.30 g/mol. IUPAC name: [(E)-but-2-enyl]-ditert-butylphosphane. InChIKey: UOOODANZONJOKI-CMDGGOBGSA-N.
| Molecular formula | C12H25P |
|---|---|
| Molecular weight | 200.30 g/mol |
| IUPAC name | [(E)-but-2-enyl]-ditert-butylphosphane |
| InChIKey | UOOODANZONJOKI-CMDGGOBGSA-N |
| SMILES | C/C=C/CP(C(C)(C)C)C(C)(C)C |
Computed by PubChem (NCBI)