CAS 1621062-98-3 appears in our catalog under these names: Triclosan Impurity 1, 2-(5-Chloro-2-(2,4-dichlorophenoxy)phenoxy)ethanol. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 100mg.
2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol (CAS 1621062-98-3) is a chemical compound with the molecular formula C14H11Cl3O3 and a molecular weight of 333.6 g/mol. IUPAC name: 2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol. InChIKey: URWHEVKXZLYYSE-UHFFFAOYSA-N.
| Molecular formula | C14H11Cl3O3 |
|---|---|
| Molecular weight | 333.6 g/mol |
| IUPAC name | 2-[5-chloro-2-(2,4-dichlorophenoxy)phenoxy]ethanol |
| InChIKey | URWHEVKXZLYYSE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCCO)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)